C32H34N2O6S — CID 170260206
9-(3-methylphenyl)-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-7-propoxy-2-propyl-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid (PubChem CID 170260206) has the molecular formula C32H34N2O6S and a molecular weight of 574.70 g/mol. Its IUPAC name is 9-(3-methylphenyl)-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-7-propoxy-2-propyl-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid.
| Compound Name | 9-(3-methylphenyl)-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-7-propoxy-2-propyl-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
|---|---|
| PubChem CID | 170260206 |
| Molecular Formula | C32H34N2O6S |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | 9-(3-methylphenyl)-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-7-propoxy-2-propyl-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
| SMILES | CCCOc1c(Cc2cccc3ccccc23)c(-c2cccc(C)c2)c2n(c1=O)C(C(=O)O)CN(CCC)S2(=O)=O |
| InChI | InChI=1S/C32H34N2O6S/c1-4-16-33-20-27(32(36)37)34-30(35)29(40-17-5-2)26(19-23-13-9-12-22-11-6-7-15-25(22)23)28(31(34)41(33,38)39)24-14-8-10-21(3)18-24/h6-15,18,27H,4-5,16-17,19-20H2,1-3H3,(H,36,37) |
| InChIKey | PHAJHBBDILITDE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.70 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |