C20H16N2O4S — CID 166181481
(2-acetamido-1,3-thiazol-4-yl)methyl 2-benzo[e][1]benzofuran-2-ylacetate (PubChem CID 166181481) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is (2-acetamido-1,3-thiazol-4-yl)methyl 2-benzo[e][1]benzofuran-2-ylacetate.
| Compound Name | (2-acetamido-1,3-thiazol-4-yl)methyl 2-benzo[e][1]benzofuran-2-ylacetate |
|---|---|
| PubChem CID | 166181481 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (2-acetamido-1,3-thiazol-4-yl)methyl 2-benzo[e][1]benzofuran-2-ylacetate |
| SMILES | CC(=O)Nc1nc(COC(=O)Cc2cc3c(ccc4ccccc43)o2)cs1 |
| InChI | InChI=1S/C20H16N2O4S/c1-12(23)21-20-22-14(11-27-20)10-25-19(24)9-15-8-17-16-5-3-2-4-13(16)6-7-18(17)26-15/h2-8,11H,9-10H2,1H3,(H,21,22,23) |
| InChIKey | XHSVGLCXHYQJCL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |