C15H16N4O3S — CID 166264489
2-(oxan-4-yl)-N'-(thiophene-2-carbonyl)pyrimidine-5-carbohydrazide (PubChem CID 166264489) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is 2-(oxan-4-yl)-N'-(thiophene-2-carbonyl)pyrimidine-5-carbohydrazide.
| Compound Name | 2-(oxan-4-yl)-N'-(thiophene-2-carbonyl)pyrimidine-5-carbohydrazide |
|---|---|
| PubChem CID | 166264489 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-(oxan-4-yl)-N'-(thiophene-2-carbonyl)pyrimidine-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cccs1)c1cnc(C2CCOCC2)nc1 |
| InChI | InChI=1S/C15H16N4O3S/c20-14(18-19-15(21)12-2-1-7-23-12)11-8-16-13(17-9-11)10-3-5-22-6-4-10/h1-2,7-10H,3-6H2,(H,18,20)(H,19,21) |
| InChIKey | KTRHQROERREYJE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|