C14H15F3N2O5S — CID 166268831
2-(3-oxomorpholin-4-yl)-N-[[3-(trifluoromethyl)phenyl]methylsulfonyl]acetamide (PubChem CID 166268831) has the molecular formula C14H15F3N2O5S and a molecular weight of 380.34 g/mol. Its IUPAC name is 2-(3-oxomorpholin-4-yl)-N-[[3-(trifluoromethyl)phenyl]methylsulfonyl]acetamide.
| Compound Name | 2-(3-oxomorpholin-4-yl)-N-[[3-(trifluoromethyl)phenyl]methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 166268831 |
| Molecular Formula | C14H15F3N2O5S |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-(3-oxomorpholin-4-yl)-N-[[3-(trifluoromethyl)phenyl]methylsulfonyl]acetamide |
| SMILES | O=C(CN1CCOCC1=O)NS(=O)(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3N2O5S/c15-14(16,17)11-3-1-2-10(6-11)9-25(22,23)18-12(20)7-19-4-5-24-8-13(19)21/h1-3,6H,4-5,7-9H2,(H,18,20) |
| InChIKey | MENONKAOSFZXBZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |