C13H12ClFN2O2S2 — CID 166308965
4-chloro-3-fluoro-2-(1-thiophen-2-ylsulfonylpyrrolidin-2-yl)pyridine (PubChem CID 166308965) has the molecular formula C13H12ClFN2O2S2 and a molecular weight of 346.84 g/mol. Its IUPAC name is 4-chloro-3-fluoro-2-(1-thiophen-2-ylsulfonylpyrrolidin-2-yl)pyridine.
| Compound Name | 4-chloro-3-fluoro-2-(1-thiophen-2-ylsulfonylpyrrolidin-2-yl)pyridine |
|---|---|
| PubChem CID | 166308965 |
| Molecular Formula | C13H12ClFN2O2S2 |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 4-chloro-3-fluoro-2-(1-thiophen-2-ylsulfonylpyrrolidin-2-yl)pyridine |
| SMILES | O=S(=O)(c1cccs1)N1CCCC1c1nccc(Cl)c1F |
| InChI | InChI=1S/C13H12ClFN2O2S2/c14-9-5-6-16-13(12(9)15)10-3-1-7-17(10)21(18,19)11-4-2-8-20-11/h2,4-6,8,10H,1,3,7H2 |
| InChIKey | IIRNDMIMQSAYHC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |