C12H11N3S2 — CID 166338530
5-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-1,3-thiazole (PubChem CID 166338530) has the molecular formula C12H11N3S2 and a molecular weight of 261.38 g/mol. Its IUPAC name is 5-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-1,3-thiazole.
| Compound Name | 5-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 166338530 |
| Molecular Formula | C12H11N3S2 |
| Molecular Weight | 261.38 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 5-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-1,3-thiazole |
| SMILES | c1ccc2[nH]c(SCCc3cncs3)nc2c1 |
| InChI | InChI=1S/C12H11N3S2/c1-2-4-11-10(3-1)14-12(15-11)16-6-5-9-7-13-8-17-9/h1-4,7-8H,5-6H2,(H,14,15) |
| InChIKey | DEVXETYNZRFVIU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |