C20H20FNO2S — CID 166360544
N-[(1R,1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-3-(3-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanamide (PubChem CID 166360544) has the molecular formula C20H20FNO2S and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[(1R,1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-3-(3-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanamide.
| Compound Name | N-[(1R,1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-3-(3-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 166360544 |
| Molecular Formula | C20H20FNO2S |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-[(1R,1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-3-(3-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanamide |
| SMILES | CC(O)(CSc1cccc(F)c1)C(=O)N[C@@H]1[C@H]2Cc3ccccc3[C@H]21 |
| InChI | InChI=1S/C20H20FNO2S/c1-20(24,11-25-14-7-4-6-13(21)10-14)19(23)22-18-16-9-12-5-2-3-8-15(12)17(16)18/h2-8,10,16-18,24H,9,11H2,1H3,(H,22,23)/t16-,17+,18+,20?/m0/s1 |
| InChIKey | QKXJXTNJYBYCNY-XMIICXPASA-N |
| XLogP | 3.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |