C10H12F5N3O2S — CID 166386054
N-[2-(carbamoylamino)ethyl]-3-(pentafluoro-λ6-sulfanyl)benzamide (PubChem CID 166386054) has the molecular formula C10H12F5N3O2S and a molecular weight of 333.28 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-3-(pentafluoro-λ6-sulfanyl)benzamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]-3-(pentafluoro-λ6-sulfanyl)benzamide |
|---|---|
| PubChem CID | 166386054 |
| Molecular Formula | C10H12F5N3O2S |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-3-(pentafluoro-λ6-sulfanyl)benzamide |
| SMILES | NC(=O)NCCNC(=O)c1cccc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F5N3O2S/c11-21(12,13,14,15)8-3-1-2-7(6-8)9(19)17-4-5-18-10(16)20/h1-3,6H,4-5H2,(H,17,19)(H3,16,18,20) |
| InChIKey | PQOSVLYRLSHDCJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|