C20H26N4O2 — CID 166401046
(E)-1-[5-(1-methyl-4,5,6,7-tetrahydroindazole-5-carbonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]pent-2-en-1-one (PubChem CID 166401046) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (E)-1-[5-(1-methyl-4,5,6,7-tetrahydroindazole-5-carbonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]pent-2-en-1-one.
| Compound Name | (E)-1-[5-(1-methyl-4,5,6,7-tetrahydroindazole-5-carbonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]pent-2-en-1-one |
|---|---|
| PubChem CID | 166401046 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (E)-1-[5-(1-methyl-4,5,6,7-tetrahydroindazole-5-carbonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]pent-2-en-1-one |
| SMILES | CC/C=C/C(=O)N1CC2=C(C1)CN(C(=O)C1CCc3c(cnn3C)C1)C2 |
| InChI | InChI=1S/C20H26N4O2/c1-3-4-5-19(25)23-10-16-12-24(13-17(16)11-23)20(26)14-6-7-18-15(8-14)9-21-22(18)2/h4-5,9,14H,3,6-8,10-13H2,1-2H3/b5-4+ |
| InChIKey | ZUHUXTXPMAHXPY-SNAWJCMRSA-N |
| XLogP | 1.47 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|