C16H17Cl2N3O3 — CID 166412320
N-[2-[[1-(2,4-dichlorophenyl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]prop-2-enamide (PubChem CID 166412320) has the molecular formula C16H17Cl2N3O3 and a molecular weight of 370.24 g/mol. Its IUPAC name is N-[2-[[1-(2,4-dichlorophenyl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]prop-2-enamide.
| Compound Name | N-[2-[[1-(2,4-dichlorophenyl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 166412320 |
| Molecular Formula | C16H17Cl2N3O3 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | N-[2-[[1-(2,4-dichlorophenyl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(=O)NC1CCCN(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C16H17Cl2N3O3/c1-2-14(22)19-9-15(23)20-12-4-3-7-21(16(12)24)13-6-5-10(17)8-11(13)18/h2,5-6,8,12H,1,3-4,7,9H2,(H,19,22)(H,20,23) |
| InChIKey | YUHAOIMTGHYQKI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|