C20H23N5O5S — CID 166423201
6-[4-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one (PubChem CID 166423201) has the molecular formula C20H23N5O5S and a molecular weight of 445.50 g/mol. Its IUPAC name is 6-[4-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[4-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 166423201 |
| Molecular Formula | C20H23N5O5S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 6-[4-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one |
| SMILES | C#CCCC1(CCC(=O)N2CCN(S(=O)(=O)c3ccc4c(c3)NC(=O)CO4)CC2)N=N1 |
| InChI | InChI=1S/C20H23N5O5S/c1-2-3-7-20(22-23-20)8-6-19(27)24-9-11-25(12-10-24)31(28,29)15-4-5-17-16(13-15)21-18(26)14-30-17/h1,4-5,13H,3,6-12,14H2,(H,21,26) |
| InChIKey | OFLWWLOGDAWCJK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 120.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|