C15H17BrF3NO5S3 — CID 166424880
3-[2-[[(1R,2R)-2-(5-bromothiophen-3-yl)cyclopropanecarbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166424880) has the molecular formula C15H17BrF3NO5S3 and a molecular weight of 524.40 g/mol. Its IUPAC name is 3-[2-[[(1R,2R)-2-(5-bromothiophen-3-yl)cyclopropanecarbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[[(1R,2R)-2-(5-bromothiophen-3-yl)cyclopropanecarbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166424880 |
| Molecular Formula | C15H17BrF3NO5S3 |
| Molecular Weight | 524.40 g/mol |
| Exact Mass | 522.94 |
| IUPAC Name | 3-[2-[[(1R,2R)-2-(5-bromothiophen-3-yl)cyclopropanecarbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCSSCCNC(=O)[C@@H]1C[C@H]1c1csc(Br)c1 |
| InChI | InChI=1S/C13H16BrNO3S3.C2HF3O2/c14-11-5-8(7-19-11)9-6-10(9)13(18)15-2-4-21-20-3-1-12(16)17;3-2(4,5)1(6)7/h5,7,9-10H,1-4,6H2,(H,15,18)(H,16,17);(H,6,7)/t9-,10+;/m0./s1 |
| InChIKey | LHSJPZVPLUHDBK-BAUSSPIASA-N |
| XLogP | 4.22 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|