About 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid
3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 166424912) has the molecular formula C14H19F6NO3S2
and a molecular weight of 427.43 g/mol. Its IUPAC name is 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid |
| PubChem CID | 166424912 |
| Molecular Formula | C14H19F6NO3S2 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | O=C(O)CCSSCCNC(=O)C1CCC(C(F)(F)F)CC1C(F)(F)F |
| InChI | InChI=1S/C14H19F6NO3S2/c15-13(16,17)8-1-2-9(10(7-8)14(18,19)20)12(24)21-4-6-26-25-5-3-11(22)23/h8-10H,1-7H2,(H,21,24)(H,22,23) |
| InChIKey | LZEIBTHTTSHJKB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid?
The IUPAC name of 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid (CID 166424912) is 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid.
What is the SMILES notation for 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid?
The canonical SMILES for 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid is O=C(O)CCSSCCNC(=O)C1CCC(C(F)(F)F)CC1C(F)(F)F.
What is the InChIKey of 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid?
The InChIKey is LZEIBTHTTSHJKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F6NO3S2/c15-13(16,17)8-1-2-9(10(7-8)14(18,19)20)12(24)21-4-6-26-25-5-3-11(22)23/h8-10H,1-7H2,(H,21,24)(H,22,23).
What are the key properties of 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid?
3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid has a molecular weight of 427.43 g/mol, XLogP of 4.12, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid is sourced from PubChem (CID 166424912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).