C14H19F6NO3S2 — CID 166424912
3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 166424912) has the molecular formula C14H19F6NO3S2 and a molecular weight of 427.43 g/mol. Its IUPAC name is 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166424912 |
| Molecular Formula | C14H19F6NO3S2 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 3-[2-[[2,4-bis(trifluoromethyl)cyclohexanecarbonyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | O=C(O)CCSSCCNC(=O)C1CCC(C(F)(F)F)CC1C(F)(F)F |
| InChI | InChI=1S/C14H19F6NO3S2/c15-13(16,17)8-1-2-9(10(7-8)14(18,19)20)12(24)21-4-6-26-25-5-3-11(22)23/h8-10H,1-7H2,(H,21,24)(H,22,23) |
| InChIKey | LZEIBTHTTSHJKB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|