C16H26N2O5S2 — CID 166424929
3-[2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-2H-pyridine-2-carbonyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 166424929) has the molecular formula C16H26N2O5S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 3-[2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-2H-pyridine-2-carbonyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-2H-pyridine-2-carbonyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166424929 |
| Molecular Formula | C16H26N2O5S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 3-[2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-2H-pyridine-2-carbonyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N1C=CCCC1C(=O)NCCSSCCC(=O)O |
| InChI | InChI=1S/C16H26N2O5S2/c1-16(2,3)23-15(22)18-9-5-4-6-12(18)14(21)17-8-11-25-24-10-7-13(19)20/h5,9,12H,4,6-8,10-11H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | SDGIKHPPRVSBGH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|