C20H38O2Si — CID 166445259
(4S,5R,6E,8E)-3,4,8-trimethyl-5-triethylsilyloxyundeca-1,6,8-trien-3-ol (PubChem CID 166445259) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is (4S,5R,6E,8E)-3,4,8-trimethyl-5-triethylsilyloxyundeca-1,6,8-trien-3-ol.
| Compound Name | (4S,5R,6E,8E)-3,4,8-trimethyl-5-triethylsilyloxyundeca-1,6,8-trien-3-ol |
|---|---|
| PubChem CID | 166445259 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (4S,5R,6E,8E)-3,4,8-trimethyl-5-triethylsilyloxyundeca-1,6,8-trien-3-ol |
| SMILES | C=CC(C)(O)[C@@H](C)[C@@H](/C=C/C(C)=C/CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H38O2Si/c1-9-14-17(6)15-16-19(18(7)20(8,21)10-2)22-23(11-3,12-4)13-5/h10,14-16,18-19,21H,2,9,11-13H2,1,3-8H3/b16-15+,17-14+/t18-,19+,20?/m0/s1 |
| InChIKey | WSCOXVQUKRXSQJ-GYGQRWPSSA-N |
| XLogP | 5.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|