C85H90N2O2 — CID 166446361
1,3-bis[2,6-bis[bis(3,5-dimethylphenyl)methyl]-4-methoxyphenyl]-2H-imidazole (PubChem CID 166446361) has the molecular formula C85H90N2O2 and a molecular weight of 1171.67 g/mol. Its IUPAC name is 1,3-bis[2,6-bis[bis(3,5-dimethylphenyl)methyl]-4-methoxyphenyl]-2H-imidazole.
| Compound Name | 1,3-bis[2,6-bis[bis(3,5-dimethylphenyl)methyl]-4-methoxyphenyl]-2H-imidazole |
|---|---|
| PubChem CID | 166446361 |
| Molecular Formula | C85H90N2O2 |
| Molecular Weight | 1171.67 g/mol |
| Exact Mass | 1170.70 |
| IUPAC Name | 1,3-bis[2,6-bis[bis(3,5-dimethylphenyl)methyl]-4-methoxyphenyl]-2H-imidazole |
| SMILES | COc1cc(C(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)c(N2C=CN(c3c(C(c4cc(C)cc(C)c4)c4cc(C)cc(C)c4)cc(OC)cc3C(c3cc(C)cc(C)c3)c3cc(C)cc(C)c3)C2)c(C(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C85H90N2O2/c1-50-21-51(2)30-66(29-50)80(67-31-52(3)22-53(4)32-67)76-45-74(88-17)46-77(81(68-33-54(5)23-55(6)34-68)69-35-56(7)24-57(8)36-69)84(76)86-19-20-87(49-86)85-78(82(70-37-58(9)25-59(10)38-70)71-39-60(11)26-61(12)40-71)47-75(89-18)48-79(85)83(72-41-62(13)27-63(14)42-72)73-43-64(15)28-65(16)44-73/h19-48,80-83H,49H2,1-18H3 |
| InChIKey | ITIPTJGFPMCCBP-UHFFFAOYSA-N |
| XLogP | 21.11 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1171.67 |
| LogP ≤ 5 | 21.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|