C19H18N2O4S — CID 166448665
(1S,12S)-15-(4-methylphenyl)sulfonyl-10-oxa-9,15-diazatetracyclo[7.6.0.01,12.03,8]pentadeca-3,5,7-trien-2-one (PubChem CID 166448665) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is (1S,12S)-15-(4-methylphenyl)sulfonyl-10-oxa-9,15-diazatetracyclo[7.6.0.01,12.03,8]pentadeca-3,5,7-trien-2-one.
| Compound Name | (1S,12S)-15-(4-methylphenyl)sulfonyl-10-oxa-9,15-diazatetracyclo[7.6.0.01,12.03,8]pentadeca-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 166448665 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (1S,12S)-15-(4-methylphenyl)sulfonyl-10-oxa-9,15-diazatetracyclo[7.6.0.01,12.03,8]pentadeca-3,5,7-trien-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@H]3CON4c5ccccc5C(=O)[C@@]342)cc1 |
| InChI | InChI=1S/C19H18N2O4S/c1-13-6-8-15(9-7-13)26(23,24)20-11-10-14-12-25-21-17-5-3-2-4-16(17)18(22)19(14,20)21/h2-9,14H,10-12H2,1H3/t14-,19-/m1/s1 |
| InChIKey | OGYKRWBCNFYIGA-AUUYWEPGSA-N |
| XLogP | 2.35 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |