C14H11BrF2O — CID 166449831
1-bromo-2-[3-(2,2-difluoroethoxy)phenyl]benzene (PubChem CID 166449831) has the molecular formula C14H11BrF2O and a molecular weight of 313.14 g/mol. Its IUPAC name is 1-bromo-2-[3-(2,2-difluoroethoxy)phenyl]benzene.
| Compound Name | 1-bromo-2-[3-(2,2-difluoroethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 166449831 |
| Molecular Formula | C14H11BrF2O |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 1-bromo-2-[3-(2,2-difluoroethoxy)phenyl]benzene |
| SMILES | FC(F)COc1cccc(-c2ccccc2Br)c1 |
| InChI | InChI=1S/C14H11BrF2O/c15-13-7-2-1-6-12(13)10-4-3-5-11(8-10)18-9-14(16)17/h1-8,14H,9H2 |
| InChIKey | KAMLKYCLNQLRAE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |