C18H26N4O3 — CID 166455279
N-(3,7-dimethyl-1-azabicyclo[3.3.1]nonan-2-yl)-2-(3-formamido-2-oxo-1-pyridinyl)acetamide (PubChem CID 166455279) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-(3,7-dimethyl-1-azabicyclo[3.3.1]nonan-2-yl)-2-(3-formamido-2-oxo-1-pyridinyl)acetamide.
| Compound Name | N-(3,7-dimethyl-1-azabicyclo[3.3.1]nonan-2-yl)-2-(3-formamido-2-oxo-1-pyridinyl)acetamide |
|---|---|
| PubChem CID | 166455279 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-(3,7-dimethyl-1-azabicyclo[3.3.1]nonan-2-yl)-2-(3-formamido-2-oxo-1-pyridinyl)acetamide |
| SMILES | CC1CC2CC(C)C(NC(=O)Cn3cccc(NC=O)c3=O)N(C1)C2 |
| InChI | InChI=1S/C18H26N4O3/c1-12-6-14-7-13(2)17(22(8-12)9-14)20-16(24)10-21-5-3-4-15(18(21)25)19-11-23/h3-5,11-14,17H,6-10H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | YJEIGJFASINMHK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|