C9H16FmNO4- — CID 166481882
fermium;2-[methyl(oxomethyl)amino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid (PubChem CID 166481882) has the molecular formula C9H16FmNO4- and a molecular weight of 459.23 g/mol. Its IUPAC name is fermium;2-[methyl(oxomethyl)amino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid.
| Compound Name | fermium;2-[methyl(oxomethyl)amino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
|---|---|
| PubChem CID | 166481882 |
| Molecular Formula | C9H16FmNO4- |
| Molecular Weight | 459.23 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | fermium;2-[methyl(oxomethyl)amino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
| SMILES | CN([C-]=O)C(COC(C)(C)C)C(=O)O.[Fm] |
| InChI | InChI=1S/C9H16NO4.Fm/c1-9(2,3)14-5-7(8(12)13)10(4)6-11;/h7H,5H2,1-4H3,(H,12,13);/q-1; |
| InChIKey | VYNBUAAWOWSUJO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|