C17H28Cl2N6 — CID 166485567
N-(5-aminopentan-2-ylidene)-5-chloro-6-piperazin-1-ylpyridine-3-carboximidamide;ethene;hydrochloride (PubChem CID 166485567) has the molecular formula C17H28Cl2N6 and a molecular weight of 387.36 g/mol. Its IUPAC name is N-(5-aminopentan-2-ylidene)-5-chloro-6-piperazin-1-ylpyridine-3-carboximidamide;ethene;hydrochloride.
| Compound Name | N-(5-aminopentan-2-ylidene)-5-chloro-6-piperazin-1-ylpyridine-3-carboximidamide;ethene;hydrochloride |
|---|---|
| PubChem CID | 166485567 |
| Molecular Formula | C17H28Cl2N6 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-(5-aminopentan-2-ylidene)-5-chloro-6-piperazin-1-ylpyridine-3-carboximidamide;ethene;hydrochloride |
| SMILES | C=C.Cl.[H]/N=C(\N=C(/C)CCCN)c1cnc(N2CCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C15H23ClN6.C2H4.ClH/c1-11(3-2-4-17)21-14(18)12-9-13(16)15(20-10-12)22-7-5-19-6-8-22;1-2;/h9-10,18-19H,2-8,17H2,1H3;1-2H2;1H/b18-14-,21-11+;; |
| InChIKey | SNYIDLTZZUHFQC-VWELFVBJSA-N |
| XLogP | 2.89 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|