C9H9N4Y- — CID 166490807
7,8-dimethyl-1,2-dihydropyrido[4,3-d]pyrimidin-2-id-4-imine;yttrium (PubChem CID 166490807) has the molecular formula C9H9N4Y- and a molecular weight of 262.10 g/mol. Its IUPAC name is 7,8-dimethyl-1,2-dihydropyrido[4,3-d]pyrimidin-2-id-4-imine;yttrium.
| Compound Name | 7,8-dimethyl-1,2-dihydropyrido[4,3-d]pyrimidin-2-id-4-imine;yttrium |
|---|---|
| PubChem CID | 166490807 |
| Molecular Formula | C9H9N4Y- |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 7,8-dimethyl-1,2-dihydropyrido[4,3-d]pyrimidin-2-id-4-imine;yttrium |
| SMILES | [H]/N=c1\n[c-][nH]c2c(C)c(C)ncc12.[Y] |
| InChI | InChI=1S/C9H9N4.Y/c1-5-6(2)11-3-7-8(5)12-4-13-9(7)10;/h3H,1-2H3,(H2,10,12,13);/q-1; |
| InChIKey | CFOCMMZZEIQGOT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|