C19H27ClN4O5S — CID 166509657
2-[2-[2-[2-[2-[4-[(5-chloro-1,3-thiazol-2-yl)diazenyl]anilino]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 166509657) has the molecular formula C19H27ClN4O5S and a molecular weight of 458.97 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[4-[(5-chloro-1,3-thiazol-2-yl)diazenyl]anilino]ethoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[2-[4-[(5-chloro-1,3-thiazol-2-yl)diazenyl]anilino]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 166509657 |
| Molecular Formula | C19H27ClN4O5S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2-[2-[2-[2-[2-[4-[(5-chloro-1,3-thiazol-2-yl)diazenyl]anilino]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | OCCOCCOCCOCCOCCNc1ccc(/N=N/c2ncc(Cl)s2)cc1 |
| InChI | InChI=1S/C19H27ClN4O5S/c20-18-15-22-19(30-18)24-23-17-3-1-16(2-4-17)21-5-7-26-9-11-28-13-14-29-12-10-27-8-6-25/h1-4,15,21,25H,5-14H2/b24-23+ |
| InChIKey | IRVOKJLYPDREGI-WCWDXBQESA-N |
| XLogP | 3.68 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|