About 1H-imidazol-2-yl 2-ethylhexanoate
1H-imidazol-2-yl 2-ethylhexanoate (PubChem CID 166514820) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 1H-imidazol-2-yl 2-ethylhexanoate.
Molecular Properties
| Compound Name | 1H-imidazol-2-yl 2-ethylhexanoate |
| PubChem CID | 166514820 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1H-imidazol-2-yl 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Oc1ncc[nH]1 |
| InChI | InChI=1S/C11H18N2O2/c1-3-5-6-9(4-2)10(14)15-11-12-7-8-13-11/h7-9H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | YCOXEPWLKUNRRK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-imidazol-2-yl 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazol-2-yl 2-ethylhexanoate?
The IUPAC name of 1H-imidazol-2-yl 2-ethylhexanoate (CID 166514820) is 1H-imidazol-2-yl 2-ethylhexanoate.
What is the SMILES notation for 1H-imidazol-2-yl 2-ethylhexanoate?
The canonical SMILES for 1H-imidazol-2-yl 2-ethylhexanoate is CCCCC(CC)C(=O)Oc1ncc[nH]1.
What is the InChIKey of 1H-imidazol-2-yl 2-ethylhexanoate?
The InChIKey is YCOXEPWLKUNRRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-3-5-6-9(4-2)10(14)15-11-12-7-8-13-11/h7-9H,3-6H2,1-2H3,(H,12,13).
What are the key properties of 1H-imidazol-2-yl 2-ethylhexanoate?
1H-imidazol-2-yl 2-ethylhexanoate has a molecular weight of 210.28 g/mol, XLogP of 2.53, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazol-2-yl 2-ethylhexanoate is sourced from PubChem (CID 166514820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).