C9H10BBrF4N2 — CID 166542568
3-bromo-2,4,5-trimethylbenzenediazonium tetrafluoroborate (PubChem CID 166542568) has the molecular formula C9H10BBrF4N2 and a molecular weight of 312.90 g/mol. Its IUPAC name is 3-bromo-2,4,5-trimethylbenzenediazonium tetrafluoroborate.
| Compound Name | 3-bromo-2,4,5-trimethylbenzenediazonium tetrafluoroborate |
|---|---|
| PubChem CID | 166542568 |
| Molecular Formula | C9H10BBrF4N2 |
| Molecular Weight | 312.90 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 3-bromo-2,4,5-trimethylbenzenediazonium tetrafluoroborate |
| SMILES | Cc1cc([N+]#N)c(C)c(Br)c1C.F[B-](F)(F)F |
| InChI | InChI=1S/C9H10BrN2.BF4/c1-5-4-8(12-11)7(3)9(10)6(5)2;2-1(3,4)5/h4H,1-3H3;/q+1;-1 |
| InChIKey | XHCXBBKNWIEJSM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.90 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|