C9H12BBrF4N2 — CID 175521890
azanylidyneazanium;2-bromo-1,3,4-trimethylbenzene;tetrafluoroborate (PubChem CID 175521890) has the molecular formula C9H12BBrF4N2 and a molecular weight of 314.92 g/mol. Its IUPAC name is azanylidyneazanium;2-bromo-1,3,4-trimethylbenzene;tetrafluoroborate.
| Compound Name | azanylidyneazanium;2-bromo-1,3,4-trimethylbenzene;tetrafluoroborate |
|---|---|
| PubChem CID | 175521890 |
| Molecular Formula | C9H12BBrF4N2 |
| Molecular Weight | 314.92 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | azanylidyneazanium;2-bromo-1,3,4-trimethylbenzene;tetrafluoroborate |
| SMILES | Cc1ccc(C)c(Br)c1C.F[B-](F)(F)F.N#[NH+] |
| InChI | InChI=1S/C9H11Br.BF4.N2/c1-6-4-5-7(2)9(10)8(6)3;2-1(3,4)5;1-2/h4-5H,1-3H3;;/q;-1;/p+1 |
| InChIKey | PCEVMLOKDPCIFY-UHFFFAOYSA-O |
| XLogP | 2.95 |
| TPSA | 47.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.92 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|