C8H11BF4S — CID 88792306
(2,3-dimethylphenyl)sulfanium tetrafluoroborate (PubChem CID 88792306) has the molecular formula C8H11BF4S and a molecular weight of 226.05 g/mol. Its IUPAC name is (2,3-dimethylphenyl)sulfanium tetrafluoroborate.
| Compound Name | (2,3-dimethylphenyl)sulfanium tetrafluoroborate |
|---|---|
| PubChem CID | 88792306 |
| Molecular Formula | C8H11BF4S |
| Molecular Weight | 226.05 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | (2,3-dimethylphenyl)sulfanium tetrafluoroborate |
| SMILES | Cc1cccc([SH2+])c1C.F[B-](F)(F)F |
| InChI | InChI=1S/C8H10S.BF4/c1-6-4-3-5-8(9)7(6)2;2-1(3,4)5/h3-5,9H,1-2H3;/q;-1/p+1 |
| InChIKey | KVVPIFNXRFKSIV-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.05 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|