C40H26O — CID 166544992
1-(1,2,3,4,5,6,7,8,10-nonadeuterio-1-naphthalen-1-yl-2H-anthracen-9-yl)naphtho[1,2-g][1]benzofuran (PubChem CID 166544992) has the molecular formula C40H26O and a molecular weight of 531.70 g/mol. Its IUPAC name is 1-(1,2,3,4,5,6,7,8,10-nonadeuterio-1-naphthalen-1-yl-2H-anthracen-9-yl)naphtho[1,2-g][1]benzofuran.
| Compound Name | 1-(1,2,3,4,5,6,7,8,10-nonadeuterio-1-naphthalen-1-yl-2H-anthracen-9-yl)naphtho[1,2-g][1]benzofuran |
|---|---|
| PubChem CID | 166544992 |
| Molecular Formula | C40H26O |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | 1-(1,2,3,4,5,6,7,8,10-nonadeuterio-1-naphthalen-1-yl-2H-anthracen-9-yl)naphtho[1,2-g][1]benzofuran |
| SMILES | [2H]C1=C([2H])C([2H])C([2H])(c2cccc3ccccc23)c2c1c([2H])c1c([2H])c([2H])c([2H])c([2H])c1c2-c1coc2c1ccc1c3ccccc3ccc12 |
| InChI | InChI=1S/C40H26O/c1-4-14-29-25(9-1)12-7-17-32(29)34-18-8-13-28-23-27-11-3-6-16-31(27)39(38(28)34)37-24-41-40-35-20-19-26-10-2-5-15-30(26)33(35)21-22-36(37)40/h1-17,19-24,34H,18H2/i3D,6D,8D,11D,13D,16D,18D,23D,34D |
| InChIKey | VVWZHRZSEJWKCQ-ABLFMNJDSA-N |
| XLogP | 11.26 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|