About 6,6-dimethylcyclohepta[b]selenophene;ethane
6,6-dimethylcyclohepta[b]selenophene;ethane (PubChem CID 166550164) has the molecular formula C13H18Se
and a molecular weight of 253.25 g/mol. Its IUPAC name is 6,6-dimethylcyclohepta[b]selenophene;ethane.
Molecular Properties
| Compound Name | 6,6-dimethylcyclohepta[b]selenophene;ethane |
| PubChem CID | 166550164 |
| Molecular Formula | C13H18Se |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 6,6-dimethylcyclohepta[b]selenophene;ethane |
| SMILES | CC.CC1(C)C=Cc2cc[se]c2C=C1 |
| InChI | InChI=1S/C11H12Se.C2H6/c1-11(2)6-3-9-5-8-12-10(9)4-7-11;1-2/h3-8H,1-2H3;1-2H3 |
| InChIKey | SKERRBDLUPTEAN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethylcyclohepta[b]selenophene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethylcyclohepta[b]selenophene;ethane?
The IUPAC name of 6,6-dimethylcyclohepta[b]selenophene;ethane (CID 166550164) is 6,6-dimethylcyclohepta[b]selenophene;ethane.
What is the SMILES notation for 6,6-dimethylcyclohepta[b]selenophene;ethane?
The canonical SMILES for 6,6-dimethylcyclohepta[b]selenophene;ethane is CC.CC1(C)C=Cc2cc[se]c2C=C1.
What is the InChIKey of 6,6-dimethylcyclohepta[b]selenophene;ethane?
The InChIKey is SKERRBDLUPTEAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Se.C2H6/c1-11(2)6-3-9-5-8-12-10(9)4-7-11;1-2/h3-8H,1-2H3;1-2H3.
What are the key properties of 6,6-dimethylcyclohepta[b]selenophene;ethane?
6,6-dimethylcyclohepta[b]selenophene;ethane has a molecular weight of 253.25 g/mol, XLogP of 3.84, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethylcyclohepta[b]selenophene;ethane is sourced from PubChem (CID 166550164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).