C13H13NO4 — CID 166552592
methyl 3-ethoxy-1-oxo-2H-isoquinoline-6-carboxylate (PubChem CID 166552592) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is methyl 3-ethoxy-1-oxo-2H-isoquinoline-6-carboxylate.
| Compound Name | methyl 3-ethoxy-1-oxo-2H-isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 166552592 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | methyl 3-ethoxy-1-oxo-2H-isoquinoline-6-carboxylate |
| SMILES | CCOc1cc2cc(C(=O)OC)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C13H13NO4/c1-3-18-11-7-9-6-8(13(16)17-2)4-5-10(9)12(15)14-11/h4-7H,3H2,1-2H3,(H,14,15) |
| InChIKey | GNFUIBKQAKQLQX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |