C24H25F2N5O2 — CID 166580547
6-[6-[1-[(1R,2R,3R,5R)-6,6-difluoro-2-methoxy-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-3-yl]isoquinolin-7-ol (PubChem CID 166580547) has the molecular formula C24H25F2N5O2 and a molecular weight of 453.49 g/mol. Its IUPAC name is 6-[6-[1-[(1R,2R,3R,5R)-6,6-difluoro-2-methoxy-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-3-yl]isoquinolin-7-ol.
| Compound Name | 6-[6-[1-[(1R,2R,3R,5R)-6,6-difluoro-2-methoxy-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-3-yl]isoquinolin-7-ol |
|---|---|
| PubChem CID | 166580547 |
| Molecular Formula | C24H25F2N5O2 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 6-[6-[1-[(1R,2R,3R,5R)-6,6-difluoro-2-methoxy-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-3-yl]isoquinolin-7-ol |
| SMILES | C=C(c1cnc(-c2cc3ccncc3cc2O)nn1)[C@H]1C[C@@]2(C)N[C@](C)(CC2(F)F)[C@@H]1OC |
| InChI | InChI=1S/C24H25F2N5O2/c1-13(17-9-23(3)24(25,26)12-22(2,31-23)20(17)33-4)18-11-28-21(30-29-18)16-7-14-5-6-27-10-15(14)8-19(16)32/h5-8,10-11,17,20,31-32H,1,9,12H2,2-4H3/t17-,20-,22-,23-/m1/s1 |
| InChIKey | IWCQFMSYANHEKT-VZGVRVRRSA-N |
| XLogP | 3.99 |
| TPSA | 93.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |