C34H44N8O3 — CID 166620985
(1S,4S)-4-methyl-12-[2-[4-(3-methylphenyl)piperazin-1-yl]acetyl]-7-phenyl-3,6,8,9,12,17-hexazatricyclo[15.3.0.05,9]icosa-5,7-diene-2,16-dione (PubChem CID 166620985) has the molecular formula C34H44N8O3 and a molecular weight of 612.78 g/mol. Its IUPAC name is (1S,4S)-4-methyl-12-[2-[4-(3-methylphenyl)piperazin-1-yl]acetyl]-7-phenyl-3,6,8,9,12,17-hexazatricyclo[15.3.0.05,9]icosa-5,7-diene-2,16-dione.
| Compound Name | (1S,4S)-4-methyl-12-[2-[4-(3-methylphenyl)piperazin-1-yl]acetyl]-7-phenyl-3,6,8,9,12,17-hexazatricyclo[15.3.0.05,9]icosa-5,7-diene-2,16-dione |
|---|---|
| PubChem CID | 166620985 |
| Molecular Formula | C34H44N8O3 |
| Molecular Weight | 612.78 g/mol |
| Exact Mass | 612.35 |
| IUPAC Name | (1S,4S)-4-methyl-12-[2-[4-(3-methylphenyl)piperazin-1-yl]acetyl]-7-phenyl-3,6,8,9,12,17-hexazatricyclo[15.3.0.05,9]icosa-5,7-diene-2,16-dione |
| SMILES | Cc1cccc(N2CCN(CC(=O)N3CCCC(=O)N4CCC[C@H]4C(=O)N[C@@H](C)c4nc(-c5ccccc5)nn4CC3)CC2)c1 |
| InChI | InChI=1S/C34H44N8O3/c1-25-9-6-12-28(23-25)39-19-17-38(18-20-39)24-31(44)40-15-8-14-30(43)41-16-7-13-29(41)34(45)35-26(2)33-36-32(37-42(33)22-21-40)27-10-4-3-5-11-27/h3-6,9-12,23,26,29H,7-8,13-22,24H2,1-2H3,(H,35,45)/t26-,29-/m0/s1 |
| InChIKey | DGUVKYHTADGBHV-WNJJXGMVSA-N |
| XLogP | 2.87 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.78 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |