C36H46N6O4 — CID 166623779
(1S,4R)-4-benzyl-12-[1-(4-methoxyphenyl)cyclopentanecarbonyl]-7-methyl-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione (PubChem CID 166623779) has the molecular formula C36H46N6O4 and a molecular weight of 626.80 g/mol. Its IUPAC name is (1S,4R)-4-benzyl-12-[1-(4-methoxyphenyl)cyclopentanecarbonyl]-7-methyl-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione.
| Compound Name | (1S,4R)-4-benzyl-12-[1-(4-methoxyphenyl)cyclopentanecarbonyl]-7-methyl-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione |
|---|---|
| PubChem CID | 166623779 |
| Molecular Formula | C36H46N6O4 |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.36 |
| IUPAC Name | (1S,4R)-4-benzyl-12-[1-(4-methoxyphenyl)cyclopentanecarbonyl]-7-methyl-3,6,8,9,12,17-hexazatricyclo[15.4.0.05,9]henicosa-5,7-diene-2,16-dione |
| SMILES | COc1ccc(C2(C(=O)N3CCCC(=O)N4CCCC[C@H]4C(=O)N[C@H](Cc4ccccc4)c4nc(C)nn4CC3)CCCC2)cc1 |
| InChI | InChI=1S/C36H46N6O4/c1-26-37-33-30(25-27-11-4-3-5-12-27)38-34(44)31-13-6-9-22-41(31)32(43)14-10-21-40(23-24-42(33)39-26)35(45)36(19-7-8-20-36)28-15-17-29(46-2)18-16-28/h3-5,11-12,15-18,30-31H,6-10,13-14,19-25H2,1-2H3,(H,38,44)/t30-,31+/m1/s1 |
| InChIKey | BRXQNBYHCQMHEI-JSOSNVBQSA-N |
| XLogP | 4.51 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |