C9H6Cl2F3N — CID 166636810
2,4-dichloro-3-[1-(trifluoromethyl)cyclopropyl]pyridine (PubChem CID 166636810) has the molecular formula C9H6Cl2F3N and a molecular weight of 256.05 g/mol. Its IUPAC name is 2,4-dichloro-3-[1-(trifluoromethyl)cyclopropyl]pyridine.
| Compound Name | 2,4-dichloro-3-[1-(trifluoromethyl)cyclopropyl]pyridine |
|---|---|
| PubChem CID | 166636810 |
| Molecular Formula | C9H6Cl2F3N |
| Molecular Weight | 256.05 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | 2,4-dichloro-3-[1-(trifluoromethyl)cyclopropyl]pyridine |
| SMILES | FC(F)(F)C1(c2c(Cl)ccnc2Cl)CC1 |
| InChI | InChI=1S/C9H6Cl2F3N/c10-5-1-4-15-7(11)6(5)8(2-3-8)9(12,13)14/h1,4H,2-3H2 |
| InChIKey | MMTMKRMATIBJOH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.05 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|