C15H19IO4 — CID 166661736
2,3-dimethoxy-5-(4-methyl-3-oxopentyl)benzoyl iodide (PubChem CID 166661736) has the molecular formula C15H19IO4 and a molecular weight of 390.22 g/mol. Its IUPAC name is 2,3-dimethoxy-5-(4-methyl-3-oxopentyl)benzoyl iodide.
| Compound Name | 2,3-dimethoxy-5-(4-methyl-3-oxopentyl)benzoyl iodide |
|---|---|
| PubChem CID | 166661736 |
| Molecular Formula | C15H19IO4 |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 2,3-dimethoxy-5-(4-methyl-3-oxopentyl)benzoyl iodide |
| SMILES | COc1cc(CCC(=O)C(C)C)cc(C(=O)I)c1OC |
| InChI | InChI=1S/C15H19IO4/c1-9(2)12(17)6-5-10-7-11(15(16)18)14(20-4)13(8-10)19-3/h7-9H,5-6H2,1-4H3 |
| InChIKey | RAQURBFOFREBDP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|