C14H17IO4 — CID 129252428
5-(2,2-dimethylpropanoyl)-2,3-dimethoxybenzoyl iodide (PubChem CID 129252428) has the molecular formula C14H17IO4 and a molecular weight of 376.19 g/mol. Its IUPAC name is 5-(2,2-dimethylpropanoyl)-2,3-dimethoxybenzoyl iodide.
| Compound Name | 5-(2,2-dimethylpropanoyl)-2,3-dimethoxybenzoyl iodide |
|---|---|
| PubChem CID | 129252428 |
| Molecular Formula | C14H17IO4 |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 5-(2,2-dimethylpropanoyl)-2,3-dimethoxybenzoyl iodide |
| SMILES | COc1cc(C(=O)C(C)(C)C)cc(C(=O)I)c1OC |
| InChI | InChI=1S/C14H17IO4/c1-14(2,3)12(16)8-6-9(13(15)17)11(19-5)10(7-8)18-4/h6-7H,1-5H3 |
| InChIKey | QGSBZIVYPQYMPD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|