C14H30N6 — CID 166668421
N-(1-hydrazinylethenyl)-3-[(1-hydrazinylethenylamino)methyl]-3,5,5-trimethylcyclohexan-1-amine (PubChem CID 166668421) has the molecular formula C14H30N6 and a molecular weight of 282.44 g/mol. Its IUPAC name is N-(1-hydrazinylethenyl)-3-[(1-hydrazinylethenylamino)methyl]-3,5,5-trimethylcyclohexan-1-amine.
| Compound Name | N-(1-hydrazinylethenyl)-3-[(1-hydrazinylethenylamino)methyl]-3,5,5-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 166668421 |
| Molecular Formula | C14H30N6 |
| Molecular Weight | 282.44 g/mol |
| Exact Mass | 282.25 |
| IUPAC Name | N-(1-hydrazinylethenyl)-3-[(1-hydrazinylethenylamino)methyl]-3,5,5-trimethylcyclohexan-1-amine |
| SMILES | C=C(NN)NCC1(C)CC(NC(=C)NN)CC(C)(C)C1 |
| InChI | InChI=1S/C14H30N6/c1-10(19-15)17-9-14(5)7-12(18-11(2)20-16)6-13(3,4)8-14/h12,17-20H,1-2,6-9,15-16H2,3-5H3 |
| InChIKey | BKCVEFFZJFQKRS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.44 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|