C19H36N2 — CID 170057296
3-[(ethenylamino)methyl]-N-hept-1-en-2-yl-3,5,5-trimethylcyclohexan-1-amine (PubChem CID 170057296) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is 3-[(ethenylamino)methyl]-N-hept-1-en-2-yl-3,5,5-trimethylcyclohexan-1-amine.
| Compound Name | 3-[(ethenylamino)methyl]-N-hept-1-en-2-yl-3,5,5-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 170057296 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | 3-[(ethenylamino)methyl]-N-hept-1-en-2-yl-3,5,5-trimethylcyclohexan-1-amine |
| SMILES | C=CNCC1(C)CC(NC(=C)CCCCC)CC(C)(C)C1 |
| InChI | InChI=1S/C19H36N2/c1-7-9-10-11-16(3)21-17-12-18(4,5)14-19(6,13-17)15-20-8-2/h8,17,20-21H,2-3,7,9-15H2,1,4-6H3 |
| InChIKey | OKWMAUZZYMHHIX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|