C14H25FO2 — CID 166671027
(3Z,5E)-3-(2-fluoroethyl)-6-methoxy-5,7-dimethylnona-3,5-dien-1-ol (PubChem CID 166671027) has the molecular formula C14H25FO2 and a molecular weight of 244.35 g/mol. Its IUPAC name is (3Z,5E)-3-(2-fluoroethyl)-6-methoxy-5,7-dimethylnona-3,5-dien-1-ol.
| Compound Name | (3Z,5E)-3-(2-fluoroethyl)-6-methoxy-5,7-dimethylnona-3,5-dien-1-ol |
|---|---|
| PubChem CID | 166671027 |
| Molecular Formula | C14H25FO2 |
| Molecular Weight | 244.35 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (3Z,5E)-3-(2-fluoroethyl)-6-methoxy-5,7-dimethylnona-3,5-dien-1-ol |
| SMILES | CCC(C)/C(OC)=C(C)\C=C(\CCO)CCF |
| InChI | InChI=1S/C14H25FO2/c1-5-11(2)14(17-4)12(3)10-13(6-8-15)7-9-16/h10-11,16H,5-9H2,1-4H3/b13-10+,14-12+ |
| InChIKey | AFEWIKCKMDXXNY-ADWQEOMMSA-N |
| XLogP | 3.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|