C28H40FN3O4S — CID 166697990
5-[4-[4-[3-(dimethylamino)prop-1-ynyl]-3-fluorophenyl]-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-2-methylsulfinyl-N-(oxan-2-yloxy)pentanamide (PubChem CID 166697990) has the molecular formula C28H40FN3O4S and a molecular weight of 533.71 g/mol. Its IUPAC name is 5-[4-[4-[3-(dimethylamino)prop-1-ynyl]-3-fluorophenyl]-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-2-methylsulfinyl-N-(oxan-2-yloxy)pentanamide.
| Compound Name | 5-[4-[4-[3-(dimethylamino)prop-1-ynyl]-3-fluorophenyl]-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-2-methylsulfinyl-N-(oxan-2-yloxy)pentanamide |
|---|---|
| PubChem CID | 166697990 |
| Molecular Formula | C28H40FN3O4S |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | 5-[4-[4-[3-(dimethylamino)prop-1-ynyl]-3-fluorophenyl]-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-2-methylsulfinyl-N-(oxan-2-yloxy)pentanamide |
| SMILES | CN(C)CC#Cc1ccc(C2=CCN(CCCC(C)(C(=O)NOC3CCCCO3)S(C)=O)CC2)cc1F |
| InChI | InChI=1S/C28H40FN3O4S/c1-28(37(4)34,27(33)30-36-26-10-5-6-20-35-26)15-8-17-32-18-13-22(14-19-32)24-12-11-23(25(29)21-24)9-7-16-31(2)3/h11-13,21,26H,5-6,8,10,14-20H2,1-4H3,(H,30,33) |
| InChIKey | HCJUSEMLJKRAHN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|