C31H38ClN3O3 — CID 166701170
(2S)-2-(3-chlorophenyl)-4-[6-[2-(1,5-dioxopentan-2-yl)-1-oxo-3H-isoindol-4-yl]hexyl-ethylamino]butanenitrile (PubChem CID 166701170) has the molecular formula C31H38ClN3O3 and a molecular weight of 536.12 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenyl)-4-[6-[2-(1,5-dioxopentan-2-yl)-1-oxo-3H-isoindol-4-yl]hexyl-ethylamino]butanenitrile.
| Compound Name | (2S)-2-(3-chlorophenyl)-4-[6-[2-(1,5-dioxopentan-2-yl)-1-oxo-3H-isoindol-4-yl]hexyl-ethylamino]butanenitrile |
|---|---|
| PubChem CID | 166701170 |
| Molecular Formula | C31H38ClN3O3 |
| Molecular Weight | 536.12 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | (2S)-2-(3-chlorophenyl)-4-[6-[2-(1,5-dioxopentan-2-yl)-1-oxo-3H-isoindol-4-yl]hexyl-ethylamino]butanenitrile |
| SMILES | CCN(CCCCCCc1cccc2c1CN(C(C=O)CCC=O)C2=O)CC[C@H](C#N)c1cccc(Cl)c1 |
| InChI | InChI=1S/C31H38ClN3O3/c1-2-34(18-16-26(21-33)25-12-7-13-27(32)20-25)17-6-4-3-5-10-24-11-8-15-29-30(24)22-35(31(29)38)28(23-37)14-9-19-36/h7-8,11-13,15,19-20,23,26,28H,2-6,9-10,14,16-18,22H2,1H3/t26-,28?/m1/s1 |
| InChIKey | BJFXTDPTGIZLGX-HSLSYKTRSA-N |
| XLogP | 5.96 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.12 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|