C30H34Cl2N4O3 — CID 166701198
2-[7-[4-[4-cyano-4-(3,5-dichlorophenyl)piperidin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide (PubChem CID 166701198) has the molecular formula C30H34Cl2N4O3 and a molecular weight of 569.53 g/mol. Its IUPAC name is 2-[7-[4-[4-cyano-4-(3,5-dichlorophenyl)piperidin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide.
| Compound Name | 2-[7-[4-[4-cyano-4-(3,5-dichlorophenyl)piperidin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide |
|---|---|
| PubChem CID | 166701198 |
| Molecular Formula | C30H34Cl2N4O3 |
| Molecular Weight | 569.53 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | 2-[7-[4-[4-cyano-4-(3,5-dichlorophenyl)piperidin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide |
| SMILES | CCCC(C(=O)NC=O)N1Cc2c(CCCCN3CCC(C#N)(c4cc(Cl)cc(Cl)c4)CC3)cccc2C1=O |
| InChI | InChI=1S/C30H34Cl2N4O3/c1-2-6-27(28(38)34-20-37)36-18-26-21(8-5-9-25(26)29(36)39)7-3-4-12-35-13-10-30(19-33,11-14-35)22-15-23(31)17-24(32)16-22/h5,8-9,15-17,20,27H,2-4,6-7,10-14,18H2,1H3,(H,34,37,38) |
| InChIKey | CTUWZPZTTMGYJV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|