C27H40N2O2 — CID 167279882
2-[3-oxo-7-[7-(spiro[3.3]heptan-2-ylamino)heptyl]-1H-isoindol-2-yl]pentanal (PubChem CID 167279882) has the molecular formula C27H40N2O2 and a molecular weight of 424.63 g/mol. Its IUPAC name is 2-[3-oxo-7-[7-(spiro[3.3]heptan-2-ylamino)heptyl]-1H-isoindol-2-yl]pentanal.
| Compound Name | 2-[3-oxo-7-[7-(spiro[3.3]heptan-2-ylamino)heptyl]-1H-isoindol-2-yl]pentanal |
|---|---|
| PubChem CID | 167279882 |
| Molecular Formula | C27H40N2O2 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.31 |
| IUPAC Name | 2-[3-oxo-7-[7-(spiro[3.3]heptan-2-ylamino)heptyl]-1H-isoindol-2-yl]pentanal |
| SMILES | CCCC(C=O)N1Cc2c(CCCCCCCNC3CC4(CCC4)C3)cccc2C1=O |
| InChI | InChI=1S/C27H40N2O2/c1-2-10-23(20-30)29-19-25-21(12-8-13-24(25)26(29)31)11-6-4-3-5-7-16-28-22-17-27(18-22)14-9-15-27/h8,12-13,20,22-23,28H,2-7,9-11,14-19H2,1H3 |
| InChIKey | JFMBYEKJWJUVRH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|