C14H32NO3P — CID 166704152
3-[amino(pentan-3-yloxy)phosphoryl]oxy-4-ethyl-3-methylhexane (PubChem CID 166704152) has the molecular formula C14H32NO3P and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-[amino(pentan-3-yloxy)phosphoryl]oxy-4-ethyl-3-methylhexane.
| Compound Name | 3-[amino(pentan-3-yloxy)phosphoryl]oxy-4-ethyl-3-methylhexane |
|---|---|
| PubChem CID | 166704152 |
| Molecular Formula | C14H32NO3P |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 3-[amino(pentan-3-yloxy)phosphoryl]oxy-4-ethyl-3-methylhexane |
| SMILES | CCC(CC)OP(N)(=O)OC(C)(CC)C(CC)CC |
| InChI | InChI=1S/C14H32NO3P/c1-7-12(8-2)14(6,11-5)18-19(15,16)17-13(9-3)10-4/h12-13H,7-11H2,1-6H3,(H2,15,16) |
| InChIKey | QCRLDAMDJWKMFM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|