C33H49N9O10 — CID 166724678
[3-methyl-3-[2-methyl-2-[6-(5-methyl-2-oxoimidazolidin-4-yl)hexanoylamino]propoxy]butyl] 4-[2-[[2-(2,4-dinitroanilino)acetyl]amino]ethyl]imidazole-1-carboxylate (PubChem CID 166724678) has the molecular formula C33H49N9O10 and a molecular weight of 731.81 g/mol. Its IUPAC name is [3-methyl-3-[2-methyl-2-[6-(5-methyl-2-oxoimidazolidin-4-yl)hexanoylamino]propoxy]butyl] 4-[2-[[2-(2,4-dinitroanilino)acetyl]amino]ethyl]imidazole-1-carboxylate.
| Compound Name | [3-methyl-3-[2-methyl-2-[6-(5-methyl-2-oxoimidazolidin-4-yl)hexanoylamino]propoxy]butyl] 4-[2-[[2-(2,4-dinitroanilino)acetyl]amino]ethyl]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 166724678 |
| Molecular Formula | C33H49N9O10 |
| Molecular Weight | 731.81 g/mol |
| Exact Mass | 731.36 |
| IUPAC Name | [3-methyl-3-[2-methyl-2-[6-(5-methyl-2-oxoimidazolidin-4-yl)hexanoylamino]propoxy]butyl] 4-[2-[[2-(2,4-dinitroanilino)acetyl]amino]ethyl]imidazole-1-carboxylate |
| SMILES | CC1NC(=O)NC1CCCCCC(=O)NC(C)(C)COC(C)(C)CCOC(=O)n1cnc(CCNC(=O)CNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H49N9O10/c1-22-25(38-30(45)37-22)9-7-6-8-10-28(43)39-32(2,3)20-52-33(4,5)14-16-51-31(46)40-19-23(36-21-40)13-15-34-29(44)18-35-26-12-11-24(41(47)48)17-27(26)42(49)50/h11-12,17,19,21-22,25,35H,6-10,13-16,18,20H2,1-5H3,(H,34,44)(H,39,43)(H2,37,38,45) |
| InChIKey | PCQBOUMGOZRSCC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 250.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|