C19H38N2 — CID 166731184
5-N-tert-butyl-5-N,7,7-trimethyl-6-methylidene-1-N-prop-1-en-2-yloctane-1,5-diamine (PubChem CID 166731184) has the molecular formula C19H38N2 and a molecular weight of 294.53 g/mol. Its IUPAC name is 5-N-tert-butyl-5-N,7,7-trimethyl-6-methylidene-1-N-prop-1-en-2-yloctane-1,5-diamine.
| Compound Name | 5-N-tert-butyl-5-N,7,7-trimethyl-6-methylidene-1-N-prop-1-en-2-yloctane-1,5-diamine |
|---|---|
| PubChem CID | 166731184 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | 5-N-tert-butyl-5-N,7,7-trimethyl-6-methylidene-1-N-prop-1-en-2-yloctane-1,5-diamine |
| SMILES | C=C(C)NCCCCC(C(=C)C(C)(C)C)N(C)C(C)(C)C |
| InChI | InChI=1S/C19H38N2/c1-15(2)20-14-12-11-13-17(16(3)18(4,5)6)21(10)19(7,8)9/h17,20H,1,3,11-14H2,2,4-10H3 |
| InChIKey | VBYRYFPCNVMILC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|