C19H28N2O5 — CID 166732033
[(2S)-1-[benzyl(2,2-dimethylbutanoyl)amino]oxy-3-methyl-1-oxobutan-2-yl]carbamic acid (PubChem CID 166732033) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is [(2S)-1-[benzyl(2,2-dimethylbutanoyl)amino]oxy-3-methyl-1-oxobutan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[benzyl(2,2-dimethylbutanoyl)amino]oxy-3-methyl-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 166732033 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | [(2S)-1-[benzyl(2,2-dimethylbutanoyl)amino]oxy-3-methyl-1-oxobutan-2-yl]carbamic acid |
| SMILES | CCC(C)(C)C(=O)N(Cc1ccccc1)OC(=O)[C@@H](NC(=O)O)C(C)C |
| InChI | InChI=1S/C19H28N2O5/c1-6-19(4,5)17(23)21(12-14-10-8-7-9-11-14)26-16(22)15(13(2)3)20-18(24)25/h7-11,13,15,20H,6,12H2,1-5H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | MHEVVZAIVSNJBO-HNNXBMFYSA-N |
| XLogP | 3.20 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|