C20H38FNO8S — CID 166733343
[3-[2-[2-[2-[2-[2-(3,3-dimethyl-4-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-fluoropropyl]carbamothioic S-acid (PubChem CID 166733343) has the molecular formula C20H38FNO8S and a molecular weight of 471.59 g/mol. Its IUPAC name is [3-[2-[2-[2-[2-[2-(3,3-dimethyl-4-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-fluoropropyl]carbamothioic S-acid.
| Compound Name | [3-[2-[2-[2-[2-[2-(3,3-dimethyl-4-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-fluoropropyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 166733343 |
| Molecular Formula | C20H38FNO8S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | [3-[2-[2-[2-[2-[2-(3,3-dimethyl-4-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-fluoropropyl]carbamothioic S-acid |
| SMILES | CC(C)(C=O)CCOCCOCCOCCOCCOCCOCC(F)CNC(=O)S |
| InChI | InChI=1S/C20H38FNO8S/c1-20(2,17-23)3-4-25-5-6-26-7-8-27-9-10-28-11-12-29-13-14-30-16-18(21)15-22-19(24)31/h17-18H,3-16H2,1-2H3,(H2,22,24,31) |
| InChIKey | ILIKHIYDWJMMCZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|