About 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[carbamothioyl(1-hydroxyethyl)amino]phenyl]urea
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[carbamothioyl(1-hydroxyethyl)amino]phenyl]urea (PubChem CID 166741294) has the molecular formula C17H23N5O3S
and a molecular weight of 377.47 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[carbamothioyl(1-hydroxyethyl)amino]phenyl]urea.
Molecular Properties
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[carbamothioyl(1-hydroxyethyl)amino]phenyl]urea |
| PubChem CID | 166741294 |
| Molecular Formula | C17H23N5O3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[carbamothioyl(1-hydroxyethyl)amino]phenyl]urea |
| SMILES | CC(O)N(C(N)=S)c1ccc(NC(=O)Nc2cc(C(C)(C)C)on2)cc1 |
| InChI | InChI=1S/C17H23N5O3S/c1-10(23)22(15(18)26)12-7-5-11(6-8-12)19-16(24)20-14-9-13(25-21-14)17(2,3)4/h5-10,23H,1-4H3,(H2,18,26)(H2,19,20,21,24) |
| InChIKey | UKHZCMVBUKXQNX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[carbamothioyl(1-hydroxyethyl)amino]phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[carbamothioyl(1-hydroxyethyl)amino]phenyl]urea?
The IUPAC name of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[carbamothioyl(1-hydroxyethyl)amino]phenyl]urea (CID 166741294) is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[carbamothioyl(1-hydroxyethyl)amino]phenyl]urea.
What is the SMILES notation for 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[carbamothioyl(1-hydroxyethyl)amino]phenyl]urea?
The canonical SMILES for 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[carbamothioyl(1-hydroxyethyl)amino]phenyl]urea is CC(O)N(C(N)=S)c1ccc(NC(=O)Nc2cc(C(C)(C)C)on2)cc1.
What is the InChIKey of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[carbamothioyl(1-hydroxyethyl)amino]phenyl]urea?
The InChIKey is UKHZCMVBUKXQNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N5O3S/c1-10(23)22(15(18)26)12-7-5-11(6-8-12)19-16(24)20-14-9-13(25-21-14)17(2,3)4/h5-10,23H,1-4H3,(H2,18,26)(H2,19,20,21,24).
What are the key properties of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[carbamothioyl(1-hydroxyethyl)amino]phenyl]urea?
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[carbamothioyl(1-hydroxyethyl)amino]phenyl]urea has a molecular weight of 377.47 g/mol, XLogP of 3.00, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[carbamothioyl(1-hydroxyethyl)amino]phenyl]urea is sourced from PubChem (CID 166741294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).