C23H26BrClFNO4S — CID 166749176
5-(4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl)-1-tert-butylsulfonyl-3-methylpyrrolidin-3-ol (PubChem CID 166749176) has the molecular formula C23H26BrClFNO4S and a molecular weight of 546.89 g/mol. Its IUPAC name is 5-(4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl)-1-tert-butylsulfonyl-3-methylpyrrolidin-3-ol.
| Compound Name | 5-(4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl)-1-tert-butylsulfonyl-3-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 166749176 |
| Molecular Formula | C23H26BrClFNO4S |
| Molecular Weight | 546.89 g/mol |
| Exact Mass | 545.04 |
| IUPAC Name | 5-(4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl)-1-tert-butylsulfonyl-3-methylpyrrolidin-3-ol |
| SMILES | CC1(O)CC(C2(c3ccccc3)Cc3c(cc(F)c(Cl)c3Br)O2)N(S(=O)(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C23H26BrClFNO4S/c1-21(2,3)32(29,30)27-13-22(4,28)12-18(27)23(14-8-6-5-7-9-14)11-15-17(31-23)10-16(26)20(25)19(15)24/h5-10,18,28H,11-13H2,1-4H3 |
| InChIKey | SDQLVJNFKAYTDY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.89 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|